C23H24O3 — CID 173361678
(1S,4R,5R,8S)-4,8-dimethyl-4-[2-(4-phenylphenyl)ethenyl]-2,3-dioxabicyclo[3.3.1]nonan-7-one (PubChem CID 173361678) has the molecular formula C23H24O3 and a molecular weight of 348.44 g/mol. Its IUPAC name is (1S,4R,5R,8S)-4,8-dimethyl-4-[2-(4-phenylphenyl)ethenyl]-2,3-dioxabicyclo[3.3.1]nonan-7-one.
| Compound Name | (1S,4R,5R,8S)-4,8-dimethyl-4-[2-(4-phenylphenyl)ethenyl]-2,3-dioxabicyclo[3.3.1]nonan-7-one |
|---|---|
| PubChem CID | 173361678 |
| Molecular Formula | C23H24O3 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (1S,4R,5R,8S)-4,8-dimethyl-4-[2-(4-phenylphenyl)ethenyl]-2,3-dioxabicyclo[3.3.1]nonan-7-one |
| SMILES | C[C@@H]1C(=O)C[C@H]2C[C@@H]1OO[C@@]2(C)C=Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24O3/c1-16-21(24)14-20-15-22(16)25-26-23(20,2)13-12-17-8-10-19(11-9-17)18-6-4-3-5-7-18/h3-13,16,20,22H,14-15H2,1-2H3/t16-,20+,22+,23+/m1/s1 |
| InChIKey | MHIFBDVNUNUESU-AAEGSUEWSA-N |
| XLogP | 5.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|