C10H22O29P6 — CID 173361828
2-hydroxy-3-[hydroxy-[(2S,3S,5R,6S)-2,3,4,5,6-pentaphosphonooxycyclohexyl]oxyphosphoryl]oxybutanedioic acid (PubChem CID 173361828) has the molecular formula C10H22O29P6 and a molecular weight of 792.10 g/mol. Its IUPAC name is 2-hydroxy-3-[hydroxy-[(2S,3S,5R,6S)-2,3,4,5,6-pentaphosphonooxycyclohexyl]oxyphosphoryl]oxybutanedioic acid.
| Compound Name | 2-hydroxy-3-[hydroxy-[(2S,3S,5R,6S)-2,3,4,5,6-pentaphosphonooxycyclohexyl]oxyphosphoryl]oxybutanedioic acid |
|---|---|
| PubChem CID | 173361828 |
| Molecular Formula | C10H22O29P6 |
| Molecular Weight | 792.10 g/mol |
| Exact Mass | 791.87 |
| IUPAC Name | 2-hydroxy-3-[hydroxy-[(2S,3S,5R,6S)-2,3,4,5,6-pentaphosphonooxycyclohexyl]oxyphosphoryl]oxybutanedioic acid |
| SMILES | O=C(O)C(O)C(OP(=O)(O)OC1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)C(OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C10H22O29P6/c11-1(9(12)13)2(10(14)15)38-45(31,32)39-8-6(36-43(25,26)27)4(34-41(19,20)21)3(33-40(16,17)18)5(35-42(22,23)24)7(8)37-44(28,29)30/h1-8,11H,(H,12,13)(H,14,15)(H,31,32)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)(H2,25,26,27)(H2,28,29,30)/t1?,2?,3?,4-,5+,6-,7-,8?/m0/s1 |
| InChIKey | IQQQQQPMOZANLB-XYVMXQAJSA-N |
| XLogP | -4.21 |
| TPSA | 484.39 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.10 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|