C15H18N2O2 — CID 173361842
4-ethylidene-N,N',2,3-tetramethylidene-5-propan-2-ylidenehexanediamide (PubChem CID 173361842) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-ethylidene-N,N',2,3-tetramethylidene-5-propan-2-ylidenehexanediamide.
| Compound Name | 4-ethylidene-N,N',2,3-tetramethylidene-5-propan-2-ylidenehexanediamide |
|---|---|
| PubChem CID | 173361842 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 4-ethylidene-N,N',2,3-tetramethylidene-5-propan-2-ylidenehexanediamide |
| SMILES | C=NC(=O)C(=C)C(=C)C(=CC)C(C(=O)N=C)=C(C)C |
| InChI | InChI=1S/C15H18N2O2/c1-8-12(10(4)11(5)14(18)16-6)13(9(2)3)15(19)17-7/h8H,4-7H2,1-3H3 |
| InChIKey | VTPLYFRJNAIPIQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|