About CID 173362036
CID 173362036 (PubChem CID 173362036) has the molecular formula C6H5OTe
and a molecular weight of 220.71 g/mol.
Molecular Properties
| Compound Name | CID 173362036 |
| PubChem CID | 173362036 |
| Molecular Formula | C6H5OTe |
| Molecular Weight | 220.71 g/mol |
| Exact Mass | 222.94 |
| IUPAC Name | — |
| SMILES | Oc1ccc([Te])cc1 |
| InChI | InChI=1S/C6H5OTe/c7-5-1-3-6(8)4-2-5/h1-4,7H |
| InChIKey | IZAXMFDSTXMHAR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.71 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173362036 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173362036?
The IUPAC name of CID 173362036 (CID 173362036) is not available.
What is the SMILES notation for CID 173362036?
The canonical SMILES for CID 173362036 is Oc1ccc([Te])cc1.
What is the InChIKey of CID 173362036?
The InChIKey is IZAXMFDSTXMHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5OTe/c7-5-1-3-6(8)4-2-5/h1-4,7H.
What are the key properties of CID 173362036?
CID 173362036 has a molecular weight of 220.71 g/mol, XLogP of 0.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173362036 is sourced from PubChem (CID 173362036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).