About 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride
1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride (PubChem CID 173362381) has the molecular formula C20H40ClN2OS+
and a molecular weight of 392.07 g/mol. Its IUPAC name is 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride |
| PubChem CID | 173362381 |
| Molecular Formula | C20H40ClN2OS+ |
| Molecular Weight | 392.07 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride |
| SMILES | CCCCCCCCCCCC[N+]1(CN2CCCC2=O)CCSC1.Cl |
| InChI | InChI=1S/C20H39N2OS.ClH/c1-2-3-4-5-6-7-8-9-10-11-15-22(16-17-24-19-22)18-21-14-12-13-20(21)23;/h2-19H2,1H3;1H/q+1; |
| InChIKey | LWUJRRLQSFBYCD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.07 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride?
The IUPAC name of 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride (CID 173362381) is 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride.
What is the SMILES notation for 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride?
The canonical SMILES for 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride is CCCCCCCCCCCC[N+]1(CN2CCCC2=O)CCSC1.Cl.
What is the InChIKey of 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride?
The InChIKey is LWUJRRLQSFBYCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39N2OS.ClH/c1-2-3-4-5-6-7-8-9-10-11-15-22(16-17-24-19-22)18-21-14-12-13-20(21)23;/h2-19H2,1H3;1H/q+1;.
What are the key properties of 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride?
1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride has a molecular weight of 392.07 g/mol, XLogP of 5.43, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-dodecyl-1,3-thiazolidin-3-ium-3-yl)methyl]pyrrolidin-2-one;hydrochloride is sourced from PubChem (CID 173362381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).