C34H55ClN8O3 — CID 173362436
formyl 8-chloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-6-carboxylate (PubChem CID 173362436) has the molecular formula C34H55ClN8O3 and a molecular weight of 659.32 g/mol. Its IUPAC name is formyl 8-chloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-6-carboxylate.
| Compound Name | formyl 8-chloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-6-carboxylate |
|---|---|
| PubChem CID | 173362436 |
| Molecular Formula | C34H55ClN8O3 |
| Molecular Weight | 659.32 g/mol |
| Exact Mass | 658.41 |
| IUPAC Name | formyl 8-chloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-6-carboxylate |
| SMILES | O=COC(=O)C1CC(Cl)C2C3NC4NC(NC5NC(NC6NC(NC(N3)C2C1)C1CCCCC61)C1CCCCC51)C1CCCCC41 |
| InChI | InChI=1S/C34H55ClN8O3/c35-24-14-16(34(45)46-15-44)13-23-25(24)33-42-31-22-12-6-5-11-21(22)29(40-31)38-27-18-8-2-1-7-17(18)26(36-27)37-28-19-9-3-4-10-20(19)30(39-28)41-32(23)43-33/h15-33,36-43H,1-14H2 |
| InChIKey | WFHOXWMLTYTWOP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|