About aziridin-2-one;2-dodecylbut-2-enediamide
aziridin-2-one;2-dodecylbut-2-enediamide (PubChem CID 173362709) has the molecular formula C18H33N3O3
and a molecular weight of 339.48 g/mol. Its IUPAC name is aziridin-2-one;2-dodecylbut-2-enediamide.
Molecular Properties
| Compound Name | aziridin-2-one;2-dodecylbut-2-enediamide |
| PubChem CID | 173362709 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | aziridin-2-one;2-dodecylbut-2-enediamide |
| SMILES | CCCCCCCCCCCCC(=CC(N)=O)C(N)=O.O=C1CN1 |
| InChI | InChI=1S/C16H30N2O2.C2H3NO/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(18)20)13-15(17)19;4-2-1-3-2/h13H,2-12H2,1H3,(H2,17,19)(H2,18,20);1H2,(H,3,4) |
| InChIKey | GAYSQBHSUKHIGA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridin-2-one;2-dodecylbut-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridin-2-one;2-dodecylbut-2-enediamide?
The IUPAC name of aziridin-2-one;2-dodecylbut-2-enediamide (CID 173362709) is aziridin-2-one;2-dodecylbut-2-enediamide.
What is the SMILES notation for aziridin-2-one;2-dodecylbut-2-enediamide?
The canonical SMILES for aziridin-2-one;2-dodecylbut-2-enediamide is CCCCCCCCCCCCC(=CC(N)=O)C(N)=O.O=C1CN1.
What is the InChIKey of aziridin-2-one;2-dodecylbut-2-enediamide?
The InChIKey is GAYSQBHSUKHIGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O2.C2H3NO/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(18)20)13-15(17)19;4-2-1-3-2/h13H,2-12H2,1H3,(H2,17,19)(H2,18,20);1H2,(H,3,4).
What are the key properties of aziridin-2-one;2-dodecylbut-2-enediamide?
aziridin-2-one;2-dodecylbut-2-enediamide has a molecular weight of 339.48 g/mol, XLogP of 2.31, 13 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aziridin-2-one;2-dodecylbut-2-enediamide is sourced from PubChem (CID 173362709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).