About potassium;hydride;phosphono decanoate
potassium;hydride;phosphono decanoate (PubChem CID 173362975) has the molecular formula C10H22KO5P
and a molecular weight of 292.35 g/mol. Its IUPAC name is potassium;hydride;phosphono decanoate.
Molecular Properties
| Compound Name | potassium;hydride;phosphono decanoate |
| PubChem CID | 173362975 |
| Molecular Formula | C10H22KO5P |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | potassium;hydride;phosphono decanoate |
| SMILES | CCCCCCCCCC(=O)OP(=O)(O)O.[H-].[K+] |
| InChI | InChI=1S/C10H21O5P.K.H/c1-2-3-4-5-6-7-8-9-10(11)15-16(12,13)14;;/h2-9H2,1H3,(H2,12,13,14);;/q;+1;-1 |
| InChIKey | XKZGEIJIBANCHC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;phosphono decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;phosphono decanoate?
The IUPAC name of potassium;hydride;phosphono decanoate (CID 173362975) is potassium;hydride;phosphono decanoate.
What is the SMILES notation for potassium;hydride;phosphono decanoate?
The canonical SMILES for potassium;hydride;phosphono decanoate is CCCCCCCCCC(=O)OP(=O)(O)O.[H-].[K+].
What is the InChIKey of potassium;hydride;phosphono decanoate?
The InChIKey is XKZGEIJIBANCHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21O5P.K.H/c1-2-3-4-5-6-7-8-9-10(11)15-16(12,13)14;;/h2-9H2,1H3,(H2,12,13,14);;/q;+1;-1.
What are the key properties of potassium;hydride;phosphono decanoate?
potassium;hydride;phosphono decanoate has a molecular weight of 292.35 g/mol, XLogP of -0.12, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;phosphono decanoate is sourced from PubChem (CID 173362975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).