About 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione
1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione (PubChem CID 173363380) has the molecular formula C14H23N2O6P
and a molecular weight of 346.32 g/mol. Its IUPAC name is 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione |
| PubChem CID | 173363380 |
| Molecular Formula | C14H23N2O6P |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP(=O)(C=CC(CO)Cn1cc(C)c(=O)[nH]c1=O)OCC |
| InChI | InChI=1S/C14H23N2O6P/c1-4-21-23(20,22-5-2)7-6-12(10-17)9-16-8-11(3)13(18)15-14(16)19/h6-8,12,17H,4-5,9-10H2,1-3H3,(H,15,18,19) |
| InChIKey | YEUQQUGPXACFJB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione?
The IUPAC name of 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione (CID 173363380) is 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione.
What is the SMILES notation for 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione?
The canonical SMILES for 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione is CCOP(=O)(C=CC(CO)Cn1cc(C)c(=O)[nH]c1=O)OCC.
What is the InChIKey of 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione?
The InChIKey is YEUQQUGPXACFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N2O6P/c1-4-21-23(20,22-5-2)7-6-12(10-17)9-16-8-11(3)13(18)15-14(16)19/h6-8,12,17H,4-5,9-10H2,1-3H3,(H,15,18,19).
What are the key properties of 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione?
1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione has a molecular weight of 346.32 g/mol, XLogP of 1.23, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-diethoxyphosphoryl-2-(hydroxymethyl)but-3-enyl]-5-methylpyrimidine-2,4-dione is sourced from PubChem (CID 173363380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).