About potassium;hydride;3-methylbutanal
potassium;hydride;3-methylbutanal (PubChem CID 173363476) has the molecular formula C5H11KO
and a molecular weight of 126.24 g/mol. Its IUPAC name is potassium;hydride;3-methylbutanal.
Molecular Properties
| Compound Name | potassium;hydride;3-methylbutanal |
| PubChem CID | 173363476 |
| Molecular Formula | C5H11KO |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | potassium;hydride;3-methylbutanal |
| SMILES | CC(C)CC=O.[H-].[K+] |
| InChI | InChI=1S/C5H10O.K.H/c1-5(2)3-4-6;;/h4-5H,3H2,1-2H3;;/q;+1;-1 |
| InChIKey | RKOZPAZCXKKQBQ-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;3-methylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;3-methylbutanal?
The IUPAC name of potassium;hydride;3-methylbutanal (CID 173363476) is potassium;hydride;3-methylbutanal.
What is the SMILES notation for potassium;hydride;3-methylbutanal?
The canonical SMILES for potassium;hydride;3-methylbutanal is CC(C)CC=O.[H-].[K+].
What is the InChIKey of potassium;hydride;3-methylbutanal?
The InChIKey is RKOZPAZCXKKQBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.K.H/c1-5(2)3-4-6;;/h4-5H,3H2,1-2H3;;/q;+1;-1.
What are the key properties of potassium;hydride;3-methylbutanal?
potassium;hydride;3-methylbutanal has a molecular weight of 126.24 g/mol, XLogP of -1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;3-methylbutanal is sourced from PubChem (CID 173363476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).