About 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane
3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane (PubChem CID 173363941) has the molecular formula C11H28N2O3Si
and a molecular weight of 264.44 g/mol. Its IUPAC name is 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane.
Molecular Properties
| Compound Name | 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane |
| PubChem CID | 173363941 |
| Molecular Formula | C11H28N2O3Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane |
| SMILES | CC=CN.CCC1CNC1.CO[SiH](OC)OC |
| InChI | InChI=1S/C5H11N.C3H7N.C3H10O3Si/c1-2-5-3-6-4-5;1-2-3-4;1-4-7(5-2)6-3/h5-6H,2-4H2,1H3;2-3H,4H2,1H3;7H,1-3H3 |
| InChIKey | PUBVDUMLGAVBCO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane?
The IUPAC name of 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane (CID 173363941) is 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane.
What is the SMILES notation for 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane?
The canonical SMILES for 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane is CC=CN.CCC1CNC1.CO[SiH](OC)OC.
What is the InChIKey of 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane?
The InChIKey is PUBVDUMLGAVBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.C3H7N.C3H10O3Si/c1-2-5-3-6-4-5;1-2-3-4;1-4-7(5-2)6-3/h5-6H,2-4H2,1H3;2-3H,4H2,1H3;7H,1-3H3.
What are the key properties of 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane?
3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane has a molecular weight of 264.44 g/mol, XLogP of 0.74, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylazetidine;prop-1-en-1-amine;trimethoxysilane is sourced from PubChem (CID 173363941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).