About cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane
cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane (PubChem CID 173364041) has the molecular formula C9H16OSi
and a molecular weight of 168.31 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane.
Molecular Properties
| Compound Name | cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane |
| PubChem CID | 173364041 |
| Molecular Formula | C9H16OSi |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane |
| SMILES | CC(C)(C)O[SiH2]C1=CC=CC1 |
| InChI | InChI=1S/C9H16OSi/c1-9(2,3)10-11-8-6-4-5-7-8/h4-6H,7,11H2,1-3H3 |
| InChIKey | SWICDARGGSCENH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane?
The IUPAC name of cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane (CID 173364041) is cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane.
What is the SMILES notation for cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane?
The canonical SMILES for cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane is CC(C)(C)O[SiH2]C1=CC=CC1.
What is the InChIKey of cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane?
The InChIKey is SWICDARGGSCENH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OSi/c1-9(2,3)10-11-8-6-4-5-7-8/h4-6H,7,11H2,1-3H3.
What are the key properties of cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane?
cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane has a molecular weight of 168.31 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-dien-1-yl-[(2-methylpropan-2-yl)oxy]silane is sourced from PubChem (CID 173364041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).