About 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide
5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide (PubChem CID 173364101) has the molecular formula C19H22Cl3NO
and a molecular weight of 386.75 g/mol. Its IUPAC name is 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide.
Molecular Properties
| Compound Name | 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide |
| PubChem CID | 173364101 |
| Molecular Formula | C19H22Cl3NO |
| Molecular Weight | 386.75 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide |
| SMILES | CC(C)C(C)NC(=O)C=CC=CC1C(Cl)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl3NO/c1-11(2)12(3)23-17(24)7-5-4-6-14-18(19(14)22)13-8-9-15(20)16(21)10-13/h4-12,14,18-19H,1-3H3,(H,23,24) |
| InChIKey | SNEFJHGRXKHGJX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.75 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide?
The IUPAC name of 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide (CID 173364101) is 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide.
What is the SMILES notation for 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide?
The canonical SMILES for 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide is CC(C)C(C)NC(=O)C=CC=CC1C(Cl)C1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide?
The InChIKey is SNEFJHGRXKHGJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22Cl3NO/c1-11(2)12(3)23-17(24)7-5-4-6-14-18(19(14)22)13-8-9-15(20)16(21)10-13/h4-12,14,18-19H,1-3H3,(H,23,24).
What are the key properties of 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide?
5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide has a molecular weight of 386.75 g/mol, XLogP of 5.59, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-chloro-3-(3,4-dichlorophenyl)cyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide is sourced from PubChem (CID 173364101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).