(iminoazaniumylideneamino) hydrogen phosphite

H2N3O3P — CID 173365208

IUPAC(iminoazaniumylideneamino) hydrogen phosphite
SMILESN=[N+]=NOP([O-])O
InChIInChI=1S/H2N3O3P/c1-2-3-6-7(4)5/h1,4H
InChIKeyVNJKHQUJFSYHEB-UHFFFAOYSA-N
MW123.01 g/mol
LogP-0.95
Rot. Bonds2

About (iminoazaniumylideneamino) hydrogen phosphite

(iminoazaniumylideneamino) hydrogen phosphite (PubChem CID 173365208) has the molecular formula H2N3O3P and a molecular weight of 123.01 g/mol. Its IUPAC name is (iminoazaniumylideneamino) hydrogen phosphite.

Molecular Properties

Compound Name(iminoazaniumylideneamino) hydrogen phosphite
PubChem CID173365208
Molecular FormulaH2N3O3P
Molecular Weight123.01 g/mol
Exact Mass122.98
IUPAC Name(iminoazaniumylideneamino) hydrogen phosphite
SMILESN=[N+]=NOP([O-])O
InChIInChI=1S/H2N3O3P/c1-2-3-6-7(4)5/h1,4H
InChIKeyVNJKHQUJFSYHEB-UHFFFAOYSA-N
XLogP-0.95
TPSA102.83 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500123.01
LogP ≤ 5-0.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze (iminoazaniumylideneamino) hydrogen phosphite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (iminoazaniumylideneamino) hydrogen phosphite?
The IUPAC name of (iminoazaniumylideneamino) hydrogen phosphite (CID 173365208) is (iminoazaniumylideneamino) hydrogen phosphite.
What is the SMILES notation for (iminoazaniumylideneamino) hydrogen phosphite?
The canonical SMILES for (iminoazaniumylideneamino) hydrogen phosphite is N=[N+]=NOP([O-])O.
What is the InChIKey of (iminoazaniumylideneamino) hydrogen phosphite?
The InChIKey is VNJKHQUJFSYHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/H2N3O3P/c1-2-3-6-7(4)5/h1,4H.
What are the key properties of (iminoazaniumylideneamino) hydrogen phosphite?
(iminoazaniumylideneamino) hydrogen phosphite has a molecular weight of 123.01 g/mol, XLogP of -0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (iminoazaniumylideneamino) hydrogen phosphite is sourced from PubChem (CID 173365208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).