C21H42O3Si2 — CID 173365390
(3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 173365390) has the molecular formula C21H42O3Si2 and a molecular weight of 398.74 g/mol. Its IUPAC name is (3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 173365390 |
| Molecular Formula | C21H42O3Si2 |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (3aS,4R,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | C[SiH](C)OC([C@@H]1[C@H]2CC(=O)C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si2/c1-20(2,3)19(23-25(7)8)18-16-13-15(22)11-14(16)12-17(18)24-26(9,10)21(4,5)6/h14,16-19,25H,11-13H2,1-10H3/t14-,16-,17+,18+,19?/m0/s1 |
| InChIKey | QPCARRXXQQGVEL-WMOVPWTDSA-N |
| XLogP | 5.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|