About fluoroboronic acid;dihydroiodide
fluoroboronic acid;dihydroiodide (PubChem CID 173365559) has the molecular formula H4BFI2O2
and a molecular weight of 319.65 g/mol. Its IUPAC name is fluoroboronic acid;dihydroiodide.
Molecular Properties
| Compound Name | fluoroboronic acid;dihydroiodide |
| PubChem CID | 173365559 |
| Molecular Formula | H4BFI2O2 |
| Molecular Weight | 319.65 g/mol |
| Exact Mass | 319.84 |
| IUPAC Name | fluoroboronic acid;dihydroiodide |
| SMILES | I.I.OB(O)F |
| InChI | InChI=1S/BFH2O2.2HI/c2-1(3)4;;/h3-4H;2*1H |
| InChIKey | BPBAFLSXHGPDCG-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.65 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze fluoroboronic acid;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroboronic acid;dihydroiodide?
The IUPAC name of fluoroboronic acid;dihydroiodide (CID 173365559) is fluoroboronic acid;dihydroiodide.
What is the SMILES notation for fluoroboronic acid;dihydroiodide?
The canonical SMILES for fluoroboronic acid;dihydroiodide is I.I.OB(O)F.
What is the InChIKey of fluoroboronic acid;dihydroiodide?
The InChIKey is BPBAFLSXHGPDCG-UHFFFAOYSA-N. The full InChI is InChI=1S/BFH2O2.2HI/c2-1(3)4;;/h3-4H;2*1H.
What are the key properties of fluoroboronic acid;dihydroiodide?
fluoroboronic acid;dihydroiodide has a molecular weight of 319.65 g/mol, XLogP of 0.16, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroboronic acid;dihydroiodide is sourced from PubChem (CID 173365559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).