C16H25N5O4S2 — CID 173366328
4-amino-3-[3-[3-[(dimethylamino)methyl]phenoxy]propylimino]-N-methyl-1-oxido-1,2-thiazol-1-ium-5-sulfonamide (PubChem CID 173366328) has the molecular formula C16H25N5O4S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-amino-3-[3-[3-[(dimethylamino)methyl]phenoxy]propylimino]-N-methyl-1-oxido-1,2-thiazol-1-ium-5-sulfonamide.
| Compound Name | 4-amino-3-[3-[3-[(dimethylamino)methyl]phenoxy]propylimino]-N-methyl-1-oxido-1,2-thiazol-1-ium-5-sulfonamide |
|---|---|
| PubChem CID | 173366328 |
| Molecular Formula | C16H25N5O4S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-amino-3-[3-[3-[(dimethylamino)methyl]phenoxy]propylimino]-N-methyl-1-oxido-1,2-thiazol-1-ium-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1c(N)/c(=N/CCCOc2cccc(CN(C)C)c2)[nH][s+]1[O-] |
| InChI | InChI=1S/C16H25N5O4S2/c1-18-27(23,24)16-14(17)15(20-26(16)22)19-8-5-9-25-13-7-4-6-12(10-13)11-21(2)3/h4,6-7,10,18H,5,8-9,11,17H2,1-3H3,(H,19,20) |
| InChIKey | NJRLBPXBCPESDE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|