About 7-chloro-6-methyl-3H-1,2-benzodioxole
7-chloro-6-methyl-3H-1,2-benzodioxole (PubChem CID 173366380) has the molecular formula C8H7ClO2
and a molecular weight of 170.59 g/mol. Its IUPAC name is 7-chloro-6-methyl-3H-1,2-benzodioxole.
Molecular Properties
| Compound Name | 7-chloro-6-methyl-3H-1,2-benzodioxole |
| PubChem CID | 173366380 |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.59 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | 7-chloro-6-methyl-3H-1,2-benzodioxole |
| SMILES | Cc1ccc2c(c1Cl)OOC2 |
| InChI | InChI=1S/C8H7ClO2/c1-5-2-3-6-4-10-11-8(6)7(5)9/h2-3H,4H2,1H3 |
| InChIKey | YPJDBUUCVIEMCH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.59 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-6-methyl-3H-1,2-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-6-methyl-3H-1,2-benzodioxole?
The IUPAC name of 7-chloro-6-methyl-3H-1,2-benzodioxole (CID 173366380) is 7-chloro-6-methyl-3H-1,2-benzodioxole.
What is the SMILES notation for 7-chloro-6-methyl-3H-1,2-benzodioxole?
The canonical SMILES for 7-chloro-6-methyl-3H-1,2-benzodioxole is Cc1ccc2c(c1Cl)OOC2.
What is the InChIKey of 7-chloro-6-methyl-3H-1,2-benzodioxole?
The InChIKey is YPJDBUUCVIEMCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO2/c1-5-2-3-6-4-10-11-8(6)7(5)9/h2-3H,4H2,1H3.
What are the key properties of 7-chloro-6-methyl-3H-1,2-benzodioxole?
7-chloro-6-methyl-3H-1,2-benzodioxole has a molecular weight of 170.59 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-6-methyl-3H-1,2-benzodioxole is sourced from PubChem (CID 173366380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).