C22H39NO3S — CID 173366498
2-(icosa-5,8,11,14-tetraenylamino)ethanesulfonic acid (PubChem CID 173366498) has the molecular formula C22H39NO3S and a molecular weight of 397.63 g/mol. Its IUPAC name is 2-(icosa-5,8,11,14-tetraenylamino)ethanesulfonic acid.
| Compound Name | 2-(icosa-5,8,11,14-tetraenylamino)ethanesulfonic acid |
|---|---|
| PubChem CID | 173366498 |
| Molecular Formula | C22H39NO3S |
| Molecular Weight | 397.63 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 2-(icosa-5,8,11,14-tetraenylamino)ethanesulfonic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCCNCCS(=O)(=O)O |
| InChI | InChI=1S/C22H39NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-21-22-27(24,25)26/h6-7,9-10,12-13,15-16,23H,2-5,8,11,14,17-22H2,1H3,(H,24,25,26) |
| InChIKey | PQIOJDCXARLEOE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|