C10H23BrOSi — CID 173367120
(1-bromo-4,6,6-trimethylheptan-4-yl)oxysilane (PubChem CID 173367120) has the molecular formula C10H23BrOSi and a molecular weight of 267.28 g/mol. Its IUPAC name is (1-bromo-4,6,6-trimethylheptan-4-yl)oxysilane.
| Compound Name | (1-bromo-4,6,6-trimethylheptan-4-yl)oxysilane |
|---|---|
| PubChem CID | 173367120 |
| Molecular Formula | C10H23BrOSi |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (1-bromo-4,6,6-trimethylheptan-4-yl)oxysilane |
| SMILES | CC(C)(C)CC(C)(CCCBr)O[SiH3] |
| InChI | InChI=1S/C10H23BrOSi/c1-9(2,3)8-10(4,12-13)6-5-7-11/h5-8H2,1-4,13H3 |
| InChIKey | CLHZULQMQXODOT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|