About 1,2-dichloro-3-iodocyclopropane;trimethoxysilane
1,2-dichloro-3-iodocyclopropane;trimethoxysilane (PubChem CID 173367126) has the molecular formula C6H13Cl2IO3Si
and a molecular weight of 359.06 g/mol. Its IUPAC name is 1,2-dichloro-3-iodocyclopropane;trimethoxysilane.
Molecular Properties
| Compound Name | 1,2-dichloro-3-iodocyclopropane;trimethoxysilane |
| PubChem CID | 173367126 |
| Molecular Formula | C6H13Cl2IO3Si |
| Molecular Weight | 359.06 g/mol |
| Exact Mass | 357.91 |
| IUPAC Name | 1,2-dichloro-3-iodocyclopropane;trimethoxysilane |
| SMILES | CO[SiH](OC)OC.ClC1C(Cl)C1I |
| InChI | InChI=1S/C3H3Cl2I.C3H10O3Si/c4-1-2(5)3(1)6;1-4-7(5-2)6-3/h1-3H;7H,1-3H3 |
| InChIKey | MCYZXZMSNJOVJM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.06 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-3-iodocyclopropane;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-3-iodocyclopropane;trimethoxysilane?
The IUPAC name of 1,2-dichloro-3-iodocyclopropane;trimethoxysilane (CID 173367126) is 1,2-dichloro-3-iodocyclopropane;trimethoxysilane.
What is the SMILES notation for 1,2-dichloro-3-iodocyclopropane;trimethoxysilane?
The canonical SMILES for 1,2-dichloro-3-iodocyclopropane;trimethoxysilane is CO[SiH](OC)OC.ClC1C(Cl)C1I.
What is the InChIKey of 1,2-dichloro-3-iodocyclopropane;trimethoxysilane?
The InChIKey is MCYZXZMSNJOVJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3Cl2I.C3H10O3Si/c4-1-2(5)3(1)6;1-4-7(5-2)6-3/h1-3H;7H,1-3H3.
What are the key properties of 1,2-dichloro-3-iodocyclopropane;trimethoxysilane?
1,2-dichloro-3-iodocyclopropane;trimethoxysilane has a molecular weight of 359.06 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-3-iodocyclopropane;trimethoxysilane is sourced from PubChem (CID 173367126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).