C31H37N5O2SSi — CID 173367513
1-tert-butyl-3-dimethylsilyl-3-[hydroxy-(1-methyltetrazol-5-yl)methyl]-4-tritylsulfanylazetidin-2-one (PubChem CID 173367513) has the molecular formula C31H37N5O2SSi and a molecular weight of 571.82 g/mol. Its IUPAC name is 1-tert-butyl-3-dimethylsilyl-3-[hydroxy-(1-methyltetrazol-5-yl)methyl]-4-tritylsulfanylazetidin-2-one.
| Compound Name | 1-tert-butyl-3-dimethylsilyl-3-[hydroxy-(1-methyltetrazol-5-yl)methyl]-4-tritylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 173367513 |
| Molecular Formula | C31H37N5O2SSi |
| Molecular Weight | 571.82 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 1-tert-butyl-3-dimethylsilyl-3-[hydroxy-(1-methyltetrazol-5-yl)methyl]-4-tritylsulfanylazetidin-2-one |
| SMILES | Cn1nnnc1C(O)C1([SiH](C)C)C(=O)N(C(C)(C)C)C1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H37N5O2SSi/c1-29(2,3)36-27(38)31(40(5)6,25(37)26-32-33-34-35(26)4)28(36)39-30(22-16-10-7-11-17-22,23-18-12-8-13-19-23)24-20-14-9-15-21-24/h7-21,25,28,37,40H,1-6H3 |
| InChIKey | HTRCPQYSHQNQBM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.82 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|