C27H26NNaO4S — CID 173367553
sodium;hydride;5-[[2-[(4-phenylmethoxyphenyl)methyl]-3,4-dihydro-2H-chromen-6-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 173367553) has the molecular formula C27H26NNaO4S and a molecular weight of 483.57 g/mol. Its IUPAC name is sodium;hydride;5-[[2-[(4-phenylmethoxyphenyl)methyl]-3,4-dihydro-2H-chromen-6-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | sodium;hydride;5-[[2-[(4-phenylmethoxyphenyl)methyl]-3,4-dihydro-2H-chromen-6-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 173367553 |
| Molecular Formula | C27H26NNaO4S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | sodium;hydride;5-[[2-[(4-phenylmethoxyphenyl)methyl]-3,4-dihydro-2H-chromen-6-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc3c(c2)CCC(Cc2ccc(OCc4ccccc4)cc2)O3)S1.[H-].[Na+] |
| InChI | InChI=1S/C27H25NO4S.Na.H/c29-26-25(33-27(30)28-26)16-20-8-13-24-21(14-20)9-12-23(32-24)15-18-6-10-22(11-7-18)31-17-19-4-2-1-3-5-19;;/h1-8,10-11,13-14,23,25H,9,12,15-17H2,(H,28,29,30);;/q;+1;-1 |
| InChIKey | FHYJDMFYEMYOBS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|