C32H36N4O2SSi — CID 173367573
1-tert-butyl-3-dimethylsilyl-3-(1-methyl-1,2,4-triazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one (PubChem CID 173367573) has the molecular formula C32H36N4O2SSi and a molecular weight of 568.82 g/mol. Its IUPAC name is 1-tert-butyl-3-dimethylsilyl-3-(1-methyl-1,2,4-triazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one.
| Compound Name | 1-tert-butyl-3-dimethylsilyl-3-(1-methyl-1,2,4-triazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 173367573 |
| Molecular Formula | C32H36N4O2SSi |
| Molecular Weight | 568.82 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 1-tert-butyl-3-dimethylsilyl-3-(1-methyl-1,2,4-triazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one |
| SMILES | Cn1cnc(C(=O)C2([SiH](C)C)C(=O)N(C(C)(C)C)C2SC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C32H36N4O2SSi/c1-30(2,3)36-28(38)32(40(5)6,26(37)27-33-22-35(4)34-27)29(36)39-31(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-22,29,40H,1-6H3 |
| InChIKey | FVKZLQSVMGTXGF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.82 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|