C32H35N3O3SSi — CID 173367605
1-tert-butyl-3-dimethylsilyl-3-(5-methyl-1,2,4-oxadiazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one (PubChem CID 173367605) has the molecular formula C32H35N3O3SSi and a molecular weight of 569.80 g/mol. Its IUPAC name is 1-tert-butyl-3-dimethylsilyl-3-(5-methyl-1,2,4-oxadiazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one.
| Compound Name | 1-tert-butyl-3-dimethylsilyl-3-(5-methyl-1,2,4-oxadiazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 173367605 |
| Molecular Formula | C32H35N3O3SSi |
| Molecular Weight | 569.80 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 1-tert-butyl-3-dimethylsilyl-3-(5-methyl-1,2,4-oxadiazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one |
| SMILES | Cc1nc(C(=O)C2([SiH](C)C)C(=O)N(C(C)(C)C)C2SC(c2ccccc2)(c2ccccc2)c2ccccc2)no1 |
| InChI | InChI=1S/C32H35N3O3SSi/c1-22-33-27(34-38-22)26(36)32(40(5)6)28(37)35(30(2,3)4)29(32)39-31(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21,29,40H,1-6H3 |
| InChIKey | WZZVLQOWEGZLSS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.80 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|