About N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride
N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride (PubChem CID 173367624) has the molecular formula C11H18Cl3N3
and a molecular weight of 298.65 g/mol. Its IUPAC name is N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride.
Molecular Properties
| Compound Name | N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride |
| PubChem CID | 173367624 |
| Molecular Formula | C11H18Cl3N3 |
| Molecular Weight | 298.65 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCCNC1=CCN2C=CC=CC2=C1 |
| InChI | InChI=1S/C11H15N3.3ClH/c12-5-6-13-10-4-8-14-7-2-1-3-11(14)9-10;;;/h1-4,7,9,13H,5-6,8,12H2;3*1H |
| InChIKey | VMQVOPMNMIMQTJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.65 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride?
The IUPAC name of N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride (CID 173367624) is N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride.
What is the SMILES notation for N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride?
The canonical SMILES for N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride is Cl.Cl.Cl.NCCNC1=CCN2C=CC=CC2=C1.
What is the InChIKey of N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride?
The InChIKey is VMQVOPMNMIMQTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3.3ClH/c12-5-6-13-10-4-8-14-7-2-1-3-11(14)9-10;;;/h1-4,7,9,13H,5-6,8,12H2;3*1H.
What are the key properties of N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride?
N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride has a molecular weight of 298.65 g/mol, XLogP of 1.97, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4H-quinolizin-2-yl)ethane-1,2-diamine;trihydrochloride is sourced from PubChem (CID 173367624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).