C19H33NO5Si — CID 173367689
prop-2-enyl (4R)-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxopentanoate (PubChem CID 173367689) has the molecular formula C19H33NO5Si and a molecular weight of 383.56 g/mol. Its IUPAC name is prop-2-enyl (4R)-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxopentanoate.
| Compound Name | prop-2-enyl (4R)-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
|---|---|
| PubChem CID | 173367689 |
| Molecular Formula | C19H33NO5Si |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | prop-2-enyl (4R)-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
| SMILES | C=CCOC(=O)CC(=O)[C@H](C)[C@H]1NC(=O)[C@@H]1[C@@](C)(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C19H33NO5Si/c1-9-10-24-14(22)11-13(21)12(2)16-15(17(23)20-16)19(6,18(3,4)5)25-26(7)8/h9,12,15-16,26H,1,10-11H2,2-8H3,(H,20,23)/t12-,15+,16+,19+/m0/s1 |
| InChIKey | GYTVFHITRNGVNN-GCUGWZBJSA-N |
| XLogP | 2.23 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|