C23H42F8O7Si4 — CID 173368512
1-O-(1,2,2,3,3,4,5,5-octafluoropentyl) 4-O-[1-tris(trimethylsilyloxy)silylpropyl] 2-ethylbut-2-enedioate (PubChem CID 173368512) has the molecular formula C23H42F8O7Si4 and a molecular weight of 694.91 g/mol. Its IUPAC name is 1-O-(1,2,2,3,3,4,5,5-octafluoropentyl) 4-O-[1-tris(trimethylsilyloxy)silylpropyl] 2-ethylbut-2-enedioate.
| Compound Name | 1-O-(1,2,2,3,3,4,5,5-octafluoropentyl) 4-O-[1-tris(trimethylsilyloxy)silylpropyl] 2-ethylbut-2-enedioate |
|---|---|
| PubChem CID | 173368512 |
| Molecular Formula | C23H42F8O7Si4 |
| Molecular Weight | 694.91 g/mol |
| Exact Mass | 694.19 |
| IUPAC Name | 1-O-(1,2,2,3,3,4,5,5-octafluoropentyl) 4-O-[1-tris(trimethylsilyloxy)silylpropyl] 2-ethylbut-2-enedioate |
| SMILES | CCC(=CC(=O)OC(CC)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)C(=O)OC(F)C(F)(F)C(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C23H42F8O7Si4/c1-12-15(20(33)35-21(27)23(30,31)22(28,29)18(24)19(25)26)14-16(32)34-17(13-2)42(36-39(3,4)5,37-40(6,7)8)38-41(9,10)11/h14,17-19,21H,12-13H2,1-11H3 |
| InChIKey | SNORUGOQGJZHOE-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.91 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|