C13H30N2NaO7S2+3 — CID 173368869
sodium;carboxymethyl(trimethyl)azanium;[1,1-dimethyl-4-(sulfinomethyl)pyrrolidin-1-ium-3-yl]methanesulfonic acid (PubChem CID 173368869) has the molecular formula C13H30N2NaO7S2+3 and a molecular weight of 413.51 g/mol. Its IUPAC name is sodium;carboxymethyl(trimethyl)azanium;[1,1-dimethyl-4-(sulfinomethyl)pyrrolidin-1-ium-3-yl]methanesulfonic acid.
| Compound Name | sodium;carboxymethyl(trimethyl)azanium;[1,1-dimethyl-4-(sulfinomethyl)pyrrolidin-1-ium-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 173368869 |
| Molecular Formula | C13H30N2NaO7S2+3 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | sodium;carboxymethyl(trimethyl)azanium;[1,1-dimethyl-4-(sulfinomethyl)pyrrolidin-1-ium-3-yl]methanesulfonic acid |
| SMILES | C[N+](C)(C)CC(=O)O.C[N+]1(C)CC(CS(=O)O)C(CS(=O)(=O)O)C1.[Na+] |
| InChI | InChI=1S/C8H17NO5S2.C5H11NO2.Na/c1-9(2)3-7(5-15(10)11)8(4-9)6-16(12,13)14;1-6(2,3)4-5(7)8;/h7-8H,3-6H2,1-2H3,(H-,10,11,12,13,14);4H2,1-3H3;/q;;+1/p+2 |
| InChIKey | LTTZTTRKEZHKJC-UHFFFAOYSA-P |
| XLogP | -3.80 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|