About CID 173369081
CID 173369081 (PubChem CID 173369081) has the molecular formula C26H56Sn2
and a molecular weight of 606.16 g/mol.
Molecular Properties
| Compound Name | CID 173369081 |
| PubChem CID | 173369081 |
| Molecular Formula | C26H56Sn2 |
| Molecular Weight | 606.16 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | — |
| SMILES | C#C.CCCC[Sn](CCCC)CCCC.CCCC[Sn](CCCC)CCCC |
| InChI | InChI=1S/6C4H9.C2H2.2Sn/c6*1-3-4-2;1-2;;/h6*1,3-4H2,2H3;1-2H;; |
| InChIKey | VNKOWRBFAJTPLS-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 606.16 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 173369081 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173369081?
The IUPAC name of CID 173369081 (CID 173369081) is not available.
What is the SMILES notation for CID 173369081?
The canonical SMILES for CID 173369081 is C#C.CCCC[Sn](CCCC)CCCC.CCCC[Sn](CCCC)CCCC.
What is the InChIKey of CID 173369081?
The InChIKey is VNKOWRBFAJTPLS-UHFFFAOYSA-N. The full InChI is InChI=1S/6C4H9.C2H2.2Sn/c6*1-3-4-2;1-2;;/h6*1,3-4H2,2H3;1-2H;;.
What are the key properties of CID 173369081?
CID 173369081 has a molecular weight of 606.16 g/mol, XLogP of 10.01, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173369081 is sourced from PubChem (CID 173369081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).