C37H44O2Sn — CID 173369223
(3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one;triphenylstannane (PubChem CID 173369223) has the molecular formula C37H44O2Sn and a molecular weight of 639.47 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one;triphenylstannane.
| Compound Name | (3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one;triphenylstannane |
|---|---|
| PubChem CID | 173369223 |
| Molecular Formula | C37H44O2Sn |
| Molecular Weight | 639.47 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one;triphenylstannane |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.c1ccc([SnH](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H28O2.3C6H5.Sn.H/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18;3*1-2-4-6-5-3-1;;/h3,13-16,20H,4-11H2,1-2H3;3*1-5H;;/t13-,14-,15-,16-,18-,19-;;;;;/m0...../s1 |
| InChIKey | NKLUPPXBCLYSBN-NHDGDWNLSA-N |
| XLogP | 5.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|