About lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate
lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate (PubChem CID 173369707) has the molecular formula C16H30LiNO2SSi2
and a molecular weight of 363.60 g/mol. Its IUPAC name is lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate.
Molecular Properties
| Compound Name | lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate |
| PubChem CID | 173369707 |
| Molecular Formula | C16H30LiNO2SSi2 |
| Molecular Weight | 363.60 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate |
| SMILES | CC=C(C(=O)OCC)c1cccs1.C[Si](C)(C)[N-][Si](C)(C)C.[Li+] |
| InChI | InChI=1S/C10H12O2S.C6H18NSi2.Li/c1-3-8(10(11)12-4-2)9-6-5-7-13-9;1-8(2,3)7-9(4,5)6;/h3,5-7H,4H2,1-2H3;1-6H3;/q;-1;+1 |
| InChIKey | IOAUVODAOVPPCA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 40.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate?
The IUPAC name of lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate (CID 173369707) is lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate.
What is the SMILES notation for lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate?
The canonical SMILES for lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate is CC=C(C(=O)OCC)c1cccs1.C[Si](C)(C)[N-][Si](C)(C)C.[Li+].
What is the InChIKey of lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate?
The InChIKey is IOAUVODAOVPPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2S.C6H18NSi2.Li/c1-3-8(10(11)12-4-2)9-6-5-7-13-9;1-8(2,3)7-9(4,5)6;/h3,5-7H,4H2,1-2H3;1-6H3;/q;-1;+1.
What are the key properties of lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate?
lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate has a molecular weight of 363.60 g/mol, XLogP of 2.75, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;bis(trimethylsilyl)azanide;ethyl 2-thiophen-2-ylbut-2-enoate is sourced from PubChem (CID 173369707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).