C8H15N5 — CID 17336981
(3-butyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)cyanamide (PubChem CID 17336981) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is (3-butyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)cyanamide.
| Compound Name | (3-butyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)cyanamide |
|---|---|
| PubChem CID | 17336981 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (3-butyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)cyanamide |
| SMILES | CCCCN1CN=C(NC#N)NC1 |
| InChI | InChI=1S/C8H15N5/c1-2-3-4-13-6-11-8(10-5-9)12-7-13/h2-4,6-7H2,1H3,(H2,10,11,12) |
| InChIKey | XTVATQPSDLEFCP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|