About 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde
5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 173369898) has the molecular formula C7H5Cl2NO3
and a molecular weight of 222.03 g/mol. Its IUPAC name is 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 173369898 |
| Molecular Formula | C7H5Cl2NO3 |
| Molecular Weight | 222.03 g/mol |
| Exact Mass | 220.96 |
| IUPAC Name | 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | O=CC1=CC=CC(Cl)(Cl)C1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5Cl2NO3/c8-7(9)3-1-2-5(4-11)6(7)10(12)13/h1-4,6H |
| InChIKey | WNBDYTASNBETHC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.03 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde (CID 173369898) is 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde is O=CC1=CC=CC(Cl)(Cl)C1[N+](=O)[O-].
What is the InChIKey of 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is WNBDYTASNBETHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2NO3/c8-7(9)3-1-2-5(4-11)6(7)10(12)13/h1-4,6H.
What are the key properties of 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde?
5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 222.03 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dichloro-6-nitrocyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 173369898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).