About N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide
N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide (PubChem CID 173370095) has the molecular formula C9H20N2O2Si
and a molecular weight of 216.36 g/mol. Its IUPAC name is N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide.
Molecular Properties
| Compound Name | N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide |
| PubChem CID | 173370095 |
| Molecular Formula | C9H20N2O2Si |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide |
| SMILES | C=C(C)C([SiH3])C(=O)NC.CNC(C)=O |
| InChI | InChI=1S/C6H13NOSi.C3H7NO/c1-4(2)5(9)6(8)7-3;1-3(5)4-2/h5H,1H2,2-3,9H3,(H,7,8);1-2H3,(H,4,5) |
| InChIKey | CKJDISAFPJXGJV-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide?
The IUPAC name of N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide (CID 173370095) is N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide.
What is the SMILES notation for N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide?
The canonical SMILES for N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide is C=C(C)C([SiH3])C(=O)NC.CNC(C)=O.
What is the InChIKey of N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide?
The InChIKey is CKJDISAFPJXGJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NOSi.C3H7NO/c1-4(2)5(9)6(8)7-3;1-3(5)4-2/h5H,1H2,2-3,9H3,(H,7,8);1-2H3,(H,4,5).
What are the key properties of N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide?
N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide has a molecular weight of 216.36 g/mol, XLogP of -0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-2-silylbut-3-enamide;N-methylacetamide is sourced from PubChem (CID 173370095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).