C29H62O6Si6 — CID 173370250
1-silyloxyethyl 2-methyl-3-[2,6,6-trimethyl-5,5-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)oxasilinan-2-yl]prop-2-enoate (PubChem CID 173370250) has the molecular formula C29H62O6Si6 and a molecular weight of 675.33 g/mol. Its IUPAC name is 1-silyloxyethyl 2-methyl-3-[2,6,6-trimethyl-5,5-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)oxasilinan-2-yl]prop-2-enoate.
| Compound Name | 1-silyloxyethyl 2-methyl-3-[2,6,6-trimethyl-5,5-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)oxasilinan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 173370250 |
| Molecular Formula | C29H62O6Si6 |
| Molecular Weight | 675.33 g/mol |
| Exact Mass | 674.32 |
| IUPAC Name | 1-silyloxyethyl 2-methyl-3-[2,6,6-trimethyl-5,5-bis(2,2,3,6,6-pentamethyloxadisilinan-3-yl)oxasilinan-2-yl]prop-2-enoate |
| SMILES | CC(=C[Si]1(C)CCC([Si]2(C)CCC(C)(C)O[Si]2(C)C)([Si]2(C)CCC(C)(C)O[Si]2(C)C)C(C)(C)O1)C(=O)OC(C)O[SiH3] |
| InChI | InChI=1S/C29H62O6Si6/c1-23(25(30)31-24(2)32-36)22-39(13)19-18-29(28(7,8)35-39,40(14)20-16-26(3,4)33-37(40,9)10)41(15)21-17-27(5,6)34-38(41,11)12/h22,24H,16-21H2,1-15,36H3 |
| InChIKey | DGKBBIAYQLIWCS-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.33 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|