C24H25N3O6 — CID 17337092
3-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-1-(2-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 17337092) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is 3-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-1-(2-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-1-(2-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 17337092 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-1-(2-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccccc1N1C(=O)CC(N2CCN(C(=O)C3COc4ccccc4O3)CC2)C1=O |
| InChI | InChI=1S/C24H25N3O6/c1-31-18-7-3-2-6-16(18)27-22(28)14-17(23(27)29)25-10-12-26(13-11-25)24(30)21-15-32-19-8-4-5-9-20(19)33-21/h2-9,17,21H,10-15H2,1H3 |
| InChIKey | RLSVSUMBHNGLJP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|