C16H13N5O2 — CID 17337122
3-amino-1-(2-hydroxyphenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]quinazolin-6-one (PubChem CID 17337122) has the molecular formula C16H13N5O2 and a molecular weight of 307.31 g/mol. Its IUPAC name is 3-amino-1-(2-hydroxyphenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]quinazolin-6-one.
| Compound Name | 3-amino-1-(2-hydroxyphenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]quinazolin-6-one |
|---|---|
| PubChem CID | 17337122 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-amino-1-(2-hydroxyphenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]quinazolin-6-one |
| SMILES | NC1=NC(c2ccccc2O)n2c(nc(=O)c3ccccc32)N1 |
| InChI | InChI=1S/C16H13N5O2/c17-15-18-13(10-6-2-4-8-12(10)22)21-11-7-3-1-5-9(11)14(23)19-16(21)20-15/h1-8,13,22H,(H3,17,18,19,20,23) |
| InChIKey | GVQTWRDFWZQHJP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|