About [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane
[(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane (PubChem CID 173372066) has the molecular formula C13H24O2Si
and a molecular weight of 240.42 g/mol. Its IUPAC name is [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane.
Molecular Properties
| Compound Name | [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane |
| PubChem CID | 173372066 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane |
| SMILES | CCC1(C2CCCC/C2=C/[SiH3])OCCCO1 |
| InChI | InChI=1S/C13H24O2Si/c1-2-13(14-8-5-9-15-13)12-7-4-3-6-11(12)10-16/h10,12H,2-9H2,1,16H3/b11-10- |
| InChIKey | LNHNLLDYNZOKEN-KHPPLWFESA-N |
| XLogP | 1.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane?
The IUPAC name of [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane (CID 173372066) is [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane.
What is the SMILES notation for [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane?
The canonical SMILES for [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane is CCC1(C2CCCC/C2=C/[SiH3])OCCCO1.
What is the InChIKey of [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane?
The InChIKey is LNHNLLDYNZOKEN-KHPPLWFESA-N. The full InChI is InChI=1S/C13H24O2Si/c1-2-13(14-8-5-9-15-13)12-7-4-3-6-11(12)10-16/h10,12H,2-9H2,1,16H3/b11-10-.
What are the key properties of [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane?
[(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane has a molecular weight of 240.42 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[2-(2-ethyl-1,3-dioxan-2-yl)cyclohexylidene]methyl]silane is sourced from PubChem (CID 173372066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).