C30H36N6O4S2 — CID 17337210
N-[4-(hexylsulfamoyl)phenyl]-2-[[5-[(2-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17337210) has the molecular formula C30H36N6O4S2 and a molecular weight of 608.79 g/mol. Its IUPAC name is N-[4-(hexylsulfamoyl)phenyl]-2-[[5-[(2-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(hexylsulfamoyl)phenyl]-2-[[5-[(2-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17337210 |
| Molecular Formula | C30H36N6O4S2 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | N-[4-(hexylsulfamoyl)phenyl]-2-[[5-[(2-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCCCCCNS(=O)(=O)c1ccc(NC(=O)CSc2nnc(CNc3ccccc3OC)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H36N6O4S2/c1-3-4-5-11-20-32-42(38,39)25-18-16-23(17-19-25)33-29(37)22-41-30-35-34-28(36(30)24-12-7-6-8-13-24)21-31-26-14-9-10-15-27(26)40-2/h6-10,12-19,31-32H,3-5,11,20-22H2,1-2H3,(H,33,37) |
| InChIKey | PTIDXRXXHMVEIV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|