About dec-1-ene;1-ethenyladamantane
dec-1-ene;1-ethenyladamantane (PubChem CID 173373199) has the molecular formula C22H38
and a molecular weight of 302.55 g/mol. Its IUPAC name is dec-1-ene;1-ethenyladamantane.
Molecular Properties
| Compound Name | dec-1-ene;1-ethenyladamantane |
| PubChem CID | 173373199 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | dec-1-ene;1-ethenyladamantane |
| SMILES | C=CC12CC3CC(CC(C3)C1)C2.C=CCCCCCCCC |
| InChI | InChI=1S/C12H18.C10H20/c1-2-12-6-9-3-10(7-12)5-11(4-9)8-12;1-3-5-7-9-10-8-6-4-2/h2,9-11H,1,3-8H2;3H,1,4-10H2,2H3 |
| InChIKey | DBGUBLRZWSWHAJ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dec-1-ene;1-ethenyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-1-ene;1-ethenyladamantane?
The IUPAC name of dec-1-ene;1-ethenyladamantane (CID 173373199) is dec-1-ene;1-ethenyladamantane.
What is the SMILES notation for dec-1-ene;1-ethenyladamantane?
The canonical SMILES for dec-1-ene;1-ethenyladamantane is C=CC12CC3CC(CC(C3)C1)C2.C=CCCCCCCCC.
What is the InChIKey of dec-1-ene;1-ethenyladamantane?
The InChIKey is DBGUBLRZWSWHAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C10H20/c1-2-12-6-9-3-10(7-12)5-11(4-9)8-12;1-3-5-7-9-10-8-6-4-2/h2,9-11H,1,3-8H2;3H,1,4-10H2,2H3.
What are the key properties of dec-1-ene;1-ethenyladamantane?
dec-1-ene;1-ethenyladamantane has a molecular weight of 302.55 g/mol, XLogP of 7.31, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dec-1-ene;1-ethenyladamantane is sourced from PubChem (CID 173373199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).