About 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile
3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile (PubChem CID 173373240) has the molecular formula C19H14N2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile |
| PubChem CID | 173373240 |
| Molecular Formula | C19H14N2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile |
| SMILES | CCc1ccc(C(=S)C=Cc2cccc(C#N)c2C#N)cc1 |
| InChI | InChI=1S/C19H14N2S/c1-2-14-6-8-16(9-7-14)19(22)11-10-15-4-3-5-17(12-20)18(15)13-21/h3-11H,2H2,1H3 |
| InChIKey | GNPPLOYFEHPQNJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile?
The IUPAC name of 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile (CID 173373240) is 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile.
What is the SMILES notation for 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile?
The canonical SMILES for 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile is CCc1ccc(C(=S)C=Cc2cccc(C#N)c2C#N)cc1.
What is the InChIKey of 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile?
The InChIKey is GNPPLOYFEHPQNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2S/c1-2-14-6-8-16(9-7-14)19(22)11-10-15-4-3-5-17(12-20)18(15)13-21/h3-11H,2H2,1H3.
What are the key properties of 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile?
3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile has a molecular weight of 302.40 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4-ethylphenyl)-3-sulfanylideneprop-1-enyl]benzene-1,2-dicarbonitrile is sourced from PubChem (CID 173373240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).