C24H47AlO6 — CID 173373263
alumane;[(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] (Z)-octadec-9-enoate (PubChem CID 173373263) has the molecular formula C24H47AlO6 and a molecular weight of 458.62 g/mol. Its IUPAC name is alumane;[(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] (Z)-octadec-9-enoate.
| Compound Name | alumane;[(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 173373263 |
| Molecular Formula | C24H47AlO6 |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | alumane;[(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O.[AlH3] |
| InChI | InChI=1S/C24H44O6.Al.3H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)29-19-21(26)24-23(28)20(25)18-30-24;;;;/h9-10,20-21,23-26,28H,2-8,11-19H2,1H3;;;;/b10-9-;;;;/t20-,21+,23+,24+;;;;/m0..../s1 |
| InChIKey | UALYIPMBYQFQKP-KBXUVLSXSA-N |
| XLogP | 2.86 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|