About 2-nitrobut-3-enenitrile
2-nitrobut-3-enenitrile (PubChem CID 173373668) has the molecular formula C4H4N2O2
and a molecular weight of 112.09 g/mol. Its IUPAC name is 2-nitrobut-3-enenitrile.
Molecular Properties
| Compound Name | 2-nitrobut-3-enenitrile |
| PubChem CID | 173373668 |
| Molecular Formula | C4H4N2O2 |
| Molecular Weight | 112.09 g/mol |
| Exact Mass | 112.03 |
| IUPAC Name | 2-nitrobut-3-enenitrile |
| SMILES | C=CC(C#N)[N+](=O)[O-] |
| InChI | InChI=1S/C4H4N2O2/c1-2-4(3-5)6(7)8/h2,4H,1H2 |
| InChIKey | CZMNRUDJIXPTCW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.09 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobut-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobut-3-enenitrile?
The IUPAC name of 2-nitrobut-3-enenitrile (CID 173373668) is 2-nitrobut-3-enenitrile.
What is the SMILES notation for 2-nitrobut-3-enenitrile?
The canonical SMILES for 2-nitrobut-3-enenitrile is C=CC(C#N)[N+](=O)[O-].
What is the InChIKey of 2-nitrobut-3-enenitrile?
The InChIKey is CZMNRUDJIXPTCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2/c1-2-4(3-5)6(7)8/h2,4H,1H2.
What are the key properties of 2-nitrobut-3-enenitrile?
2-nitrobut-3-enenitrile has a molecular weight of 112.09 g/mol, XLogP of 0.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobut-3-enenitrile is sourced from PubChem (CID 173373668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).