About acetylene;1-methyl-2-propylcyclopropane;propane
acetylene;1-methyl-2-propylcyclopropane;propane (PubChem CID 173373842) has the molecular formula C12H24
and a molecular weight of 168.32 g/mol. Its IUPAC name is acetylene;1-methyl-2-propylcyclopropane;propane.
Molecular Properties
| Compound Name | acetylene;1-methyl-2-propylcyclopropane;propane |
| PubChem CID | 173373842 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | acetylene;1-methyl-2-propylcyclopropane;propane |
| SMILES | C#C.CCC.CCCC1CC1C |
| InChI | InChI=1S/C7H14.C3H8.C2H2/c1-3-4-7-5-6(7)2;1-3-2;1-2/h6-7H,3-5H2,1-2H3;3H2,1-2H3;1-2H |
| InChIKey | WJSXFXAXEVLFCY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;1-methyl-2-propylcyclopropane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;1-methyl-2-propylcyclopropane;propane?
The IUPAC name of acetylene;1-methyl-2-propylcyclopropane;propane (CID 173373842) is acetylene;1-methyl-2-propylcyclopropane;propane.
What is the SMILES notation for acetylene;1-methyl-2-propylcyclopropane;propane?
The canonical SMILES for acetylene;1-methyl-2-propylcyclopropane;propane is C#C.CCC.CCCC1CC1C.
What is the InChIKey of acetylene;1-methyl-2-propylcyclopropane;propane?
The InChIKey is WJSXFXAXEVLFCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C3H8.C2H2/c1-3-4-7-5-6(7)2;1-3-2;1-2/h6-7H,3-5H2,1-2H3;3H2,1-2H3;1-2H.
What are the key properties of acetylene;1-methyl-2-propylcyclopropane;propane?
acetylene;1-methyl-2-propylcyclopropane;propane has a molecular weight of 168.32 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;1-methyl-2-propylcyclopropane;propane is sourced from PubChem (CID 173373842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).