C56H60Br2Cl2N2O4 — CID 173375445
4,7-dibromo-5,6-dichloro-3,3-bis[2-[4-[1-(2-cyclohexylethoxy)ethylamino]phenyl]-2-phenylethenyl]-2-benzofuran-1-one (PubChem CID 173375445) has the molecular formula C56H60Br2Cl2N2O4 and a molecular weight of 1055.82 g/mol. Its IUPAC name is 4,7-dibromo-5,6-dichloro-3,3-bis[2-[4-[1-(2-cyclohexylethoxy)ethylamino]phenyl]-2-phenylethenyl]-2-benzofuran-1-one.
| Compound Name | 4,7-dibromo-5,6-dichloro-3,3-bis[2-[4-[1-(2-cyclohexylethoxy)ethylamino]phenyl]-2-phenylethenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 173375445 |
| Molecular Formula | C56H60Br2Cl2N2O4 |
| Molecular Weight | 1055.82 g/mol |
| Exact Mass | 1052.23 |
| IUPAC Name | 4,7-dibromo-5,6-dichloro-3,3-bis[2-[4-[1-(2-cyclohexylethoxy)ethylamino]phenyl]-2-phenylethenyl]-2-benzofuran-1-one |
| SMILES | CC(Nc1ccc(C(=CC2(C=C(c3ccccc3)c3ccc(NC(C)OCCC4CCCCC4)cc3)OC(=O)c3c(Br)c(Cl)c(Cl)c(Br)c32)c2ccccc2)cc1)OCCC1CCCCC1 |
| InChI | InChI=1S/C56H60Br2Cl2N2O4/c1-37(64-33-31-39-15-7-3-8-16-39)61-45-27-23-43(24-28-45)47(41-19-11-5-12-20-41)35-56(50-49(55(63)66-56)51(57)53(59)54(60)52(50)58)36-48(42-21-13-6-14-22-42)44-25-29-46(30-26-44)62-38(2)65-34-32-40-17-9-4-10-18-40/h5-6,11-14,19-30,35-40,61-62H,3-4,7-10,15-18,31-34H2,1-2H3 |
| InChIKey | PWQMOOIYGQVCEF-UHFFFAOYSA-N |
| XLogP | 16.64 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1055.82 |
| LogP ≤ 5 | 16.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|