About 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one
6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one (PubChem CID 173375590) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one |
| PubChem CID | 173375590 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one |
| SMILES | COC1(c2ncncn2)C=CC=CC1=O |
| InChI | InChI=1S/C10H9N3O2/c1-15-10(5-3-2-4-8(10)14)9-12-6-11-7-13-9/h2-7H,1H3 |
| InChIKey | QCILDDJSAHTDJG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one?
The IUPAC name of 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one (CID 173375590) is 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one is COC1(c2ncncn2)C=CC=CC1=O.
What is the InChIKey of 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one?
The InChIKey is QCILDDJSAHTDJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c1-15-10(5-3-2-4-8(10)14)9-12-6-11-7-13-9/h2-7H,1H3.
What are the key properties of 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one?
6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one has a molecular weight of 203.20 g/mol, XLogP of 0.41, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-6-(1,3,5-triazin-2-yl)cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 173375590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).