C31H47ClO3SSi — CID 173376579
[9-(benzenesulfonyl)-6-chloro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dienoxy]-[1-tritio-2-(tritiomethyl)but-3-en-2-yl]silane (PubChem CID 173376579) has the molecular formula C31H47ClO3SSi and a molecular weight of 567.34 g/mol. Its IUPAC name is [9-(benzenesulfonyl)-6-chloro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dienoxy]-[1-tritio-2-(tritiomethyl)but-3-en-2-yl]silane.
| Compound Name | [9-(benzenesulfonyl)-6-chloro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dienoxy]-[1-tritio-2-(tritiomethyl)but-3-en-2-yl]silane |
|---|---|
| PubChem CID | 173376579 |
| Molecular Formula | C31H47ClO3SSi |
| Molecular Weight | 567.34 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | [9-(benzenesulfonyl)-6-chloro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dienoxy]-[1-tritio-2-(tritiomethyl)but-3-en-2-yl]silane |
| SMILES | [3H]CC(C=C)(C[3H])[SiH2]OCC=C(C)CCC(Cl)C(C)=CC(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H47ClO3SSi/c1-9-31(7,8)37-35-21-19-23(2)17-18-27(32)25(4)22-28(29-24(3)14-13-20-30(29,5)6)36(33,34)26-15-11-10-12-16-26/h9-12,15-16,19,22,27-28H,1,13-14,17-18,20-21,37H2,2-8H3/i7T,8T |
| InChIKey | VZMNHOKHGGHHQS-PTGCLLIWSA-N |
| XLogP | 8.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.34 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|