About 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane
2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane (PubChem CID 173376934) has the molecular formula C20H35NO2Si
and a molecular weight of 349.59 g/mol. Its IUPAC name is 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane.
Molecular Properties
| Compound Name | 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane |
| PubChem CID | 173376934 |
| Molecular Formula | C20H35NO2Si |
| Molecular Weight | 349.59 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane |
| SMILES | C[SiH2]C(C)(C)Oc1ccc(CC(C)CN2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C20H35NO2Si/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)23-20(4,5)24-6/h7-10,15-17H,11-14,24H2,1-6H3 |
| InChIKey | ROLMMOUPVAHPRA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane?
The IUPAC name of 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane (CID 173376934) is 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane.
What is the SMILES notation for 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane?
The canonical SMILES for 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane is C[SiH2]C(C)(C)Oc1ccc(CC(C)CN2CC(C)OC(C)C2)cc1.
What is the InChIKey of 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane?
The InChIKey is ROLMMOUPVAHPRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35NO2Si/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)23-20(4,5)24-6/h7-10,15-17H,11-14,24H2,1-6H3.
What are the key properties of 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane?
2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane has a molecular weight of 349.59 g/mol, XLogP of 3.31, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenoxy]propan-2-yl-methylsilane is sourced from PubChem (CID 173376934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).