About 1,2,3-benzodiazaphosphol-3-ium 3-oxide
1,2,3-benzodiazaphosphol-3-ium 3-oxide (PubChem CID 173377005) has the molecular formula C6H4N2OP+
and a molecular weight of 151.08 g/mol. Its IUPAC name is 1,2,3-benzodiazaphosphol-3-ium 3-oxide.
Molecular Properties
| Compound Name | 1,2,3-benzodiazaphosphol-3-ium 3-oxide |
| PubChem CID | 173377005 |
| Molecular Formula | C6H4N2OP+ |
| Molecular Weight | 151.08 g/mol |
| Exact Mass | 151.01 |
| IUPAC Name | 1,2,3-benzodiazaphosphol-3-ium 3-oxide |
| SMILES | O=[P+]1N=Nc2ccccc21 |
| InChI | InChI=1S/C6H4N2OP/c9-10-6-4-2-1-3-5(6)7-8-10/h1-4H/q+1 |
| InChIKey | DJHURGXCMZBGIA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-benzodiazaphosphol-3-ium 3-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-benzodiazaphosphol-3-ium 3-oxide?
The IUPAC name of 1,2,3-benzodiazaphosphol-3-ium 3-oxide (CID 173377005) is 1,2,3-benzodiazaphosphol-3-ium 3-oxide.
What is the SMILES notation for 1,2,3-benzodiazaphosphol-3-ium 3-oxide?
The canonical SMILES for 1,2,3-benzodiazaphosphol-3-ium 3-oxide is O=[P+]1N=Nc2ccccc21.
What is the InChIKey of 1,2,3-benzodiazaphosphol-3-ium 3-oxide?
The InChIKey is DJHURGXCMZBGIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2OP/c9-10-6-4-2-1-3-5(6)7-8-10/h1-4H/q+1.
What are the key properties of 1,2,3-benzodiazaphosphol-3-ium 3-oxide?
1,2,3-benzodiazaphosphol-3-ium 3-oxide has a molecular weight of 151.08 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-benzodiazaphosphol-3-ium 3-oxide is sourced from PubChem (CID 173377005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).